C20H23BrN2O4 — CID 19208062
4-(2-bromo-4-methylphenoxy)-N-[(E)-(2,5-dimethoxyphenyl)methylideneamino]butanamide (PubChem CID 19208062) has the molecular formula C20H23BrN2O4 and a molecular weight of 435.32 g/mol. Its IUPAC name is 4-(2-bromo-4-methylphenoxy)-N-[(E)-(2,5-dimethoxyphenyl)methylideneamino]butanamide.
| Compound Name | 4-(2-bromo-4-methylphenoxy)-N-[(E)-(2,5-dimethoxyphenyl)methylideneamino]butanamide |
|---|---|
| PubChem CID | 19208062 |
| Molecular Formula | C20H23BrN2O4 |
| Molecular Weight | 435.32 g/mol |
| Exact Mass | 434.08 |
| IUPAC Name | 4-(2-bromo-4-methylphenoxy)-N-[(E)-(2,5-dimethoxyphenyl)methylideneamino]butanamide |
| SMILES | COc1ccc(OC)c(/C=N/NC(=O)CCCOc2ccc(C)cc2Br)c1 |
| InChI | InChI=1S/C20H23BrN2O4/c1-14-6-8-19(17(21)11-14)27-10-4-5-20(24)23-22-13-15-12-16(25-2)7-9-18(15)26-3/h6-9,11-13H,4-5,10H2,1-3H3,(H,23,24)/b22-13+ |
| InChIKey | IGRGPSWFGBGZMI-LPYMAVHISA-N |
| XLogP | 4.08 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.32 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|