C25H36N2O4 — CID 118612061
tert-butyl N-[6-[[(2S)-2-(6-methoxynaphthalen-2-yl)propanoyl]amino]hexyl]carbamate (PubChem CID 118612061) has the molecular formula C25H36N2O4 and a molecular weight of 428.57 g/mol. Its IUPAC name is tert-butyl N-[6-[[(2S)-2-(6-methoxynaphthalen-2-yl)propanoyl]amino]hexyl]carbamate.
| Compound Name | tert-butyl N-[6-[[(2S)-2-(6-methoxynaphthalen-2-yl)propanoyl]amino]hexyl]carbamate |
|---|---|
| PubChem CID | 118612061 |
| Molecular Formula | C25H36N2O4 |
| Molecular Weight | 428.57 g/mol |
| Exact Mass | 428.27 |
| IUPAC Name | tert-butyl N-[6-[[(2S)-2-(6-methoxynaphthalen-2-yl)propanoyl]amino]hexyl]carbamate |
| SMILES | COc1ccc2cc([C@H](C)C(=O)NCCCCCCNC(=O)OC(C)(C)C)ccc2c1 |
| InChI | InChI=1S/C25H36N2O4/c1-18(19-10-11-21-17-22(30-5)13-12-20(21)16-19)23(28)26-14-8-6-7-9-15-27-24(29)31-25(2,3)4/h10-13,16-18H,6-9,14-15H2,1-5H3,(H,26,28)(H,27,29)/t18-/m0/s1 |
| InChIKey | VXWCXIZJIWCDRW-SFHVURJKSA-N |
| XLogP | 5.15 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.57 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|