C25H35NO5 — CID 44598010
tert-butyl N-[5-[bis(4-methoxyphenyl)methoxy]pentyl]carbamate (PubChem CID 44598010) has the molecular formula C25H35NO5 and a molecular weight of 429.56 g/mol. Its IUPAC name is tert-butyl N-[5-[bis(4-methoxyphenyl)methoxy]pentyl]carbamate.
| Compound Name | tert-butyl N-[5-[bis(4-methoxyphenyl)methoxy]pentyl]carbamate |
|---|---|
| PubChem CID | 44598010 |
| Molecular Formula | C25H35NO5 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.25 |
| IUPAC Name | tert-butyl N-[5-[bis(4-methoxyphenyl)methoxy]pentyl]carbamate |
| SMILES | COc1ccc(C(OCCCCCNC(=O)OC(C)(C)C)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C25H35NO5/c1-25(2,3)31-24(27)26-17-7-6-8-18-30-23(19-9-13-21(28-4)14-10-19)20-11-15-22(29-5)16-12-20/h9-16,23H,6-8,17-18H2,1-5H3,(H,26,27) |
| InChIKey | QKVTUDZZGADYTA-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|