C29H44N8O4 — CID 142745875
propan-2-yl N-[(2S)-1-[4-[[7-(2,6-dimethylmorpholin-4-yl)-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]butylamino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 142745875) has the molecular formula C29H44N8O4 and a molecular weight of 568.72 g/mol. Its IUPAC name is propan-2-yl N-[(2S)-1-[4-[[7-(2,6-dimethylmorpholin-4-yl)-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]butylamino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | propan-2-yl N-[(2S)-1-[4-[[7-(2,6-dimethylmorpholin-4-yl)-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]butylamino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 142745875 |
| Molecular Formula | C29H44N8O4 |
| Molecular Weight | 568.72 g/mol |
| Exact Mass | 568.35 |
| IUPAC Name | propan-2-yl N-[(2S)-1-[4-[[7-(2,6-dimethylmorpholin-4-yl)-1-methyl-[1,2,4]triazolo[4,3-a]quinoxalin-4-yl]amino]butylamino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | Cc1nnc2c(NCCCCNC(=O)[C@@H](NC(=O)OC(C)C)C(C)C)nc3cc(N4CC(C)OC(C)C4)ccc3n12 |
| InChI | InChI=1S/C29H44N8O4/c1-17(2)25(33-29(39)40-18(3)4)28(38)31-13-9-8-12-30-26-27-35-34-21(7)37(27)24-11-10-22(14-23(24)32-26)36-15-19(5)41-20(6)16-36/h10-11,14,17-20,25H,8-9,12-13,15-16H2,1-7H3,(H,30,32)(H,31,38)(H,33,39)/t19?,20?,25-/m0/s1 |
| InChIKey | QDKIMBLGMFUVQA-FGJIOPLASA-N |
| XLogP | 3.67 |
| TPSA | 135.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.72 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|