C19H29N3O3 — CID 162384003
tert-butyl N-[4-[1-(4-aminophenyl)-5-oxopyrrolidin-3-yl]butyl]carbamate (PubChem CID 162384003) has the molecular formula C19H29N3O3 and a molecular weight of 347.46 g/mol. Its IUPAC name is tert-butyl N-[4-[1-(4-aminophenyl)-5-oxopyrrolidin-3-yl]butyl]carbamate.
| Compound Name | tert-butyl N-[4-[1-(4-aminophenyl)-5-oxopyrrolidin-3-yl]butyl]carbamate |
|---|---|
| PubChem CID | 162384003 |
| Molecular Formula | C19H29N3O3 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.22 |
| IUPAC Name | tert-butyl N-[4-[1-(4-aminophenyl)-5-oxopyrrolidin-3-yl]butyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCC1CC(=O)N(c2ccc(N)cc2)C1 |
| InChI | InChI=1S/C19H29N3O3/c1-19(2,3)25-18(24)21-11-5-4-6-14-12-17(23)22(13-14)16-9-7-15(20)8-10-16/h7-10,14H,4-6,11-13,20H2,1-3H3,(H,21,24) |
| InChIKey | LMIIQBZHVKOUQK-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|