C16H29BrN2O3 — CID 168503582
tert-butyl N-[6-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]hexyl]carbamate (PubChem CID 168503582) has the molecular formula C16H29BrN2O3 and a molecular weight of 377.32 g/mol. Its IUPAC name is tert-butyl N-[6-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]hexyl]carbamate.
| Compound Name | tert-butyl N-[6-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]hexyl]carbamate |
|---|---|
| PubChem CID | 168503582 |
| Molecular Formula | C16H29BrN2O3 |
| Molecular Weight | 377.32 g/mol |
| Exact Mass | 376.14 |
| IUPAC Name | tert-butyl N-[6-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]hexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCCN1CC(CBr)CC1=O |
| InChI | InChI=1S/C16H29BrN2O3/c1-16(2,3)22-15(21)18-8-6-4-5-7-9-19-12-13(11-17)10-14(19)20/h13H,4-12H2,1-3H3,(H,18,21) |
| InChIKey | XOFWUKAWAKEBLH-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.32 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|