C15H27ClN2O3 — CID 168506900
tert-butyl N-[3-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]-2,2-dimethylpropyl]carbamate (PubChem CID 168506900) has the molecular formula C15H27ClN2O3 and a molecular weight of 318.85 g/mol. Its IUPAC name is tert-butyl N-[3-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]-2,2-dimethylpropyl]carbamate.
| Compound Name | tert-butyl N-[3-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]-2,2-dimethylpropyl]carbamate |
|---|---|
| PubChem CID | 168506900 |
| Molecular Formula | C15H27ClN2O3 |
| Molecular Weight | 318.85 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | tert-butyl N-[3-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]-2,2-dimethylpropyl]carbamate |
| SMILES | CC(C)(CNC(=O)OC(C)(C)C)CN1CC(CCl)CC1=O |
| InChI | InChI=1S/C15H27ClN2O3/c1-14(2,3)21-13(20)17-9-15(4,5)10-18-8-11(7-16)6-12(18)19/h11H,6-10H2,1-5H3,(H,17,20) |
| InChIKey | HHIPGIPDAULABQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.85 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|