C14H25ClN2O3S2 — CID 168506907
tert-butyl N-[2-[2-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]ethyldisulfanyl]ethyl]carbamate (PubChem CID 168506907) has the molecular formula C14H25ClN2O3S2 and a molecular weight of 368.95 g/mol. Its IUPAC name is tert-butyl N-[2-[2-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]ethyldisulfanyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]ethyldisulfanyl]ethyl]carbamate |
|---|---|
| PubChem CID | 168506907 |
| Molecular Formula | C14H25ClN2O3S2 |
| Molecular Weight | 368.95 g/mol |
| Exact Mass | 368.10 |
| IUPAC Name | tert-butyl N-[2-[2-[4-(chloromethyl)-2-oxopyrrolidin-1-yl]ethyldisulfanyl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCSSCCN1CC(CCl)CC1=O |
| InChI | InChI=1S/C14H25ClN2O3S2/c1-14(2,3)20-13(19)16-4-6-21-22-7-5-17-10-11(9-15)8-12(17)18/h11H,4-10H2,1-3H3,(H,16,19) |
| InChIKey | RPDOZGJYRKYMMM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.95 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|