C14H24N2O5S2 — CID 168690443
1-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyldisulfanyl]ethyl]-5-oxopyrrolidine-3-carboxylic acid (PubChem CID 168690443) has the molecular formula C14H24N2O5S2 and a molecular weight of 364.49 g/mol. Its IUPAC name is 1-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyldisulfanyl]ethyl]-5-oxopyrrolidine-3-carboxylic acid.
| Compound Name | 1-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyldisulfanyl]ethyl]-5-oxopyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 168690443 |
| Molecular Formula | C14H24N2O5S2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 1-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethyldisulfanyl]ethyl]-5-oxopyrrolidine-3-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)NCCSSCCN1CC(C(=O)O)CC1=O |
| InChI | InChI=1S/C14H24N2O5S2/c1-14(2,3)21-13(20)15-4-6-22-23-7-5-16-9-10(12(18)19)8-11(16)17/h10H,4-9H2,1-3H3,(H,15,20)(H,18,19) |
| InChIKey | HONLPKBGZUQWHZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|