C7H12BrNO4S — CID 168504951
2-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]ethanesulfonic acid (PubChem CID 168504951) has the molecular formula C7H12BrNO4S and a molecular weight of 286.15 g/mol. Its IUPAC name is 2-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]ethanesulfonic acid.
| Compound Name | 2-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]ethanesulfonic acid |
|---|---|
| PubChem CID | 168504951 |
| Molecular Formula | C7H12BrNO4S |
| Molecular Weight | 286.15 g/mol |
| Exact Mass | 284.97 |
| IUPAC Name | 2-[4-(bromomethyl)-2-oxopyrrolidin-1-yl]ethanesulfonic acid |
| SMILES | O=C1CC(CBr)CN1CCS(=O)(=O)O |
| InChI | InChI=1S/C7H12BrNO4S/c8-4-6-3-7(10)9(5-6)1-2-14(11,12)13/h6H,1-5H2,(H,11,12,13) |
| InChIKey | VMHSAISBPABARV-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.15 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|