C7H11NO6S — CID 83295024
5-oxo-1-(2-sulfoethyl)pyrrolidine-3-carboxylic acid (PubChem CID 83295024) has the molecular formula C7H11NO6S and a molecular weight of 237.23 g/mol. Its IUPAC name is 5-oxo-1-(2-sulfoethyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 5-oxo-1-(2-sulfoethyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 83295024 |
| Molecular Formula | C7H11NO6S |
| Molecular Weight | 237.23 g/mol |
| Exact Mass | 237.03 |
| IUPAC Name | 5-oxo-1-(2-sulfoethyl)pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CC(=O)N(CCS(=O)(=O)O)C1 |
| InChI | InChI=1S/C7H11NO6S/c9-6-3-5(7(10)11)4-8(6)1-2-15(12,13)14/h5H,1-4H2,(H,10,11)(H,12,13,14) |
| InChIKey | FFTYNYJGGAWGBL-UHFFFAOYSA-N |
| XLogP | -1.19 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.23 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|