C6H12N2O4S — CID 168700166
2-(4-amino-2-oxopyrrolidin-1-yl)ethanesulfonic acid (PubChem CID 168700166) has the molecular formula C6H12N2O4S and a molecular weight of 208.24 g/mol. Its IUPAC name is 2-(4-amino-2-oxopyrrolidin-1-yl)ethanesulfonic acid.
| Compound Name | 2-(4-amino-2-oxopyrrolidin-1-yl)ethanesulfonic acid |
|---|---|
| PubChem CID | 168700166 |
| Molecular Formula | C6H12N2O4S |
| Molecular Weight | 208.24 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 2-(4-amino-2-oxopyrrolidin-1-yl)ethanesulfonic acid |
| SMILES | NC1CC(=O)N(CCS(=O)(=O)O)C1 |
| InChI | InChI=1S/C6H12N2O4S/c7-5-3-6(9)8(4-5)1-2-13(10,11)12/h5H,1-4,7H2,(H,10,11,12) |
| InChIKey | DYXUIVDNCFWKLP-UHFFFAOYSA-N |
| XLogP | -1.57 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.24 |
| LogP ≤ 5 | -1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|