C8H19Cl2N3O — CID 82021991
4-amino-1-[2-(dimethylamino)ethyl]pyrrolidin-2-one;dihydrochloride (PubChem CID 82021991) has the molecular formula C8H19Cl2N3O and a molecular weight of 244.17 g/mol. Its IUPAC name is 4-amino-1-[2-(dimethylamino)ethyl]pyrrolidin-2-one;dihydrochloride.
| Compound Name | 4-amino-1-[2-(dimethylamino)ethyl]pyrrolidin-2-one;dihydrochloride |
|---|---|
| PubChem CID | 82021991 |
| Molecular Formula | C8H19Cl2N3O |
| Molecular Weight | 244.17 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | 4-amino-1-[2-(dimethylamino)ethyl]pyrrolidin-2-one;dihydrochloride |
| SMILES | CN(C)CCN1CC(N)CC1=O.Cl.Cl |
| InChI | InChI=1S/C8H17N3O.2ClH/c1-10(2)3-4-11-6-7(9)5-8(11)12;;/h7H,3-6,9H2,1-2H3;2*1H |
| InChIKey | HXZFKVCRZDULLH-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.17 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |