C12H14Cl2N2O — CID 168700170
4-amino-1-[2-(2,5-dichlorophenyl)ethyl]pyrrolidin-2-one (PubChem CID 168700170) has the molecular formula C12H14Cl2N2O and a molecular weight of 273.16 g/mol. Its IUPAC name is 4-amino-1-[2-(2,5-dichlorophenyl)ethyl]pyrrolidin-2-one.
| Compound Name | 4-amino-1-[2-(2,5-dichlorophenyl)ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 168700170 |
| Molecular Formula | C12H14Cl2N2O |
| Molecular Weight | 273.16 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 4-amino-1-[2-(2,5-dichlorophenyl)ethyl]pyrrolidin-2-one |
| SMILES | NC1CC(=O)N(CCc2cc(Cl)ccc2Cl)C1 |
| InChI | InChI=1S/C12H14Cl2N2O/c13-9-1-2-11(14)8(5-9)3-4-16-7-10(15)6-12(16)17/h1-2,5,10H,3-4,6-7,15H2 |
| InChIKey | GSKADGJJJZRROV-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.16 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |