C13H16N2O3 — CID 82159571
4-amino-1-[2-(1,3-benzodioxol-5-yl)ethyl]pyrrolidin-2-one (PubChem CID 82159571) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 4-amino-1-[2-(1,3-benzodioxol-5-yl)ethyl]pyrrolidin-2-one.
| Compound Name | 4-amino-1-[2-(1,3-benzodioxol-5-yl)ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 82159571 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 4-amino-1-[2-(1,3-benzodioxol-5-yl)ethyl]pyrrolidin-2-one |
| SMILES | NC1CC(=O)N(CCc2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C13H16N2O3/c14-10-6-13(16)15(7-10)4-3-9-1-2-11-12(5-9)18-8-17-11/h1-2,5,10H,3-4,6-8,14H2 |
| InChIKey | PDCDSSOQILKKIG-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |