C13H14Cl3NO — CID 168508277
4-(chloromethyl)-1-[2-(2,5-dichlorophenyl)ethyl]pyrrolidin-2-one (PubChem CID 168508277) has the molecular formula C13H14Cl3NO and a molecular weight of 306.62 g/mol. Its IUPAC name is 4-(chloromethyl)-1-[2-(2,5-dichlorophenyl)ethyl]pyrrolidin-2-one.
| Compound Name | 4-(chloromethyl)-1-[2-(2,5-dichlorophenyl)ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 168508277 |
| Molecular Formula | C13H14Cl3NO |
| Molecular Weight | 306.62 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | 4-(chloromethyl)-1-[2-(2,5-dichlorophenyl)ethyl]pyrrolidin-2-one |
| SMILES | O=C1CC(CCl)CN1CCc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H14Cl3NO/c14-7-9-5-13(18)17(8-9)4-3-10-6-11(15)1-2-12(10)16/h1-2,6,9H,3-5,7-8H2 |
| InChIKey | LBYUTPHSEIYOKT-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.62 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|