C8H16N2O3 — CID 168699407
4-amino-1-(2,2-dimethoxyethyl)pyrrolidin-2-one (PubChem CID 168699407) has the molecular formula C8H16N2O3 and a molecular weight of 188.23 g/mol. Its IUPAC name is 4-amino-1-(2,2-dimethoxyethyl)pyrrolidin-2-one.
| Compound Name | 4-amino-1-(2,2-dimethoxyethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168699407 |
| Molecular Formula | C8H16N2O3 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 4-amino-1-(2,2-dimethoxyethyl)pyrrolidin-2-one |
| SMILES | COC(CN1CC(N)CC1=O)OC |
| InChI | InChI=1S/C8H16N2O3/c1-12-8(13-2)5-10-4-6(9)3-7(10)11/h6,8H,3-5,9H2,1-2H3 |
| InChIKey | AKVCJJVTQRJJFZ-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|