C10H15NO3 — CID 168500673
1-(2,2-dimethoxyethyl)-4-ethynylpyrrolidin-2-one (PubChem CID 168500673) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is 1-(2,2-dimethoxyethyl)-4-ethynylpyrrolidin-2-one.
| Compound Name | 1-(2,2-dimethoxyethyl)-4-ethynylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168500673 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | 1-(2,2-dimethoxyethyl)-4-ethynylpyrrolidin-2-one |
| SMILES | C#CC1CC(=O)N(CC(OC)OC)C1 |
| InChI | InChI=1S/C10H15NO3/c1-4-8-5-9(12)11(6-8)7-10(13-2)14-3/h1,8,10H,5-7H2,2-3H3 |
| InChIKey | ONVANYJMNBXDJR-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|