C10H14N2O2 — CID 168500605
2-(4-ethynyl-2-oxopyrrolidin-1-yl)-N,N-dimethylacetamide (PubChem CID 168500605) has the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. Its IUPAC name is 2-(4-ethynyl-2-oxopyrrolidin-1-yl)-N,N-dimethylacetamide.
| Compound Name | 2-(4-ethynyl-2-oxopyrrolidin-1-yl)-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 168500605 |
| Molecular Formula | C10H14N2O2 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 2-(4-ethynyl-2-oxopyrrolidin-1-yl)-N,N-dimethylacetamide |
| SMILES | C#CC1CC(=O)N(CC(=O)N(C)C)C1 |
| InChI | InChI=1S/C10H14N2O2/c1-4-8-5-9(13)12(6-8)7-10(14)11(2)3/h1,8H,5-7H2,2-3H3 |
| InChIKey | AYXCNOINJSJQBF-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|