C8H15N3O4S — CID 168717165
N,N-dimethyl-2-(2-oxo-4-sulfamoylpyrrolidin-1-yl)acetamide (PubChem CID 168717165) has the molecular formula C8H15N3O4S and a molecular weight of 249.29 g/mol. Its IUPAC name is N,N-dimethyl-2-(2-oxo-4-sulfamoylpyrrolidin-1-yl)acetamide.
| Compound Name | N,N-dimethyl-2-(2-oxo-4-sulfamoylpyrrolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 168717165 |
| Molecular Formula | C8H15N3O4S |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | N,N-dimethyl-2-(2-oxo-4-sulfamoylpyrrolidin-1-yl)acetamide |
| SMILES | CN(C)C(=O)CN1CC(S(N)(=O)=O)CC1=O |
| InChI | InChI=1S/C8H15N3O4S/c1-10(2)8(13)5-11-4-6(3-7(11)12)16(9,14)15/h6H,3-5H2,1-2H3,(H2,9,14,15) |
| InChIKey | IWNXMCXZCQZOPX-UHFFFAOYSA-N |
| XLogP | -2.04 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |