C10H22N2O6SSi — CID 168717350
5-oxo-1-(3-trimethoxysilylpropyl)pyrrolidine-3-sulfonamide (PubChem CID 168717350) has the molecular formula C10H22N2O6SSi and a molecular weight of 326.45 g/mol. Its IUPAC name is 5-oxo-1-(3-trimethoxysilylpropyl)pyrrolidine-3-sulfonamide.
| Compound Name | 5-oxo-1-(3-trimethoxysilylpropyl)pyrrolidine-3-sulfonamide |
|---|---|
| PubChem CID | 168717350 |
| Molecular Formula | C10H22N2O6SSi |
| Molecular Weight | 326.45 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 5-oxo-1-(3-trimethoxysilylpropyl)pyrrolidine-3-sulfonamide |
| SMILES | CO[Si](CCCN1CC(S(N)(=O)=O)CC1=O)(OC)OC |
| InChI | InChI=1S/C10H22N2O6SSi/c1-16-20(17-2,18-3)6-4-5-12-8-9(7-10(12)13)19(11,14)15/h9H,4-8H2,1-3H3,(H2,11,14,15) |
| InChIKey | WMMPIQDSGPHDDR-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 108.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.45 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|