C10H20FNO5SSi — CID 168714021
1-[3-[dimethoxy(methyl)silyl]propyl]-5-oxopyrrolidine-3-sulfonyl fluoride (PubChem CID 168714021) has the molecular formula C10H20FNO5SSi and a molecular weight of 313.42 g/mol. Its IUPAC name is 1-[3-[dimethoxy(methyl)silyl]propyl]-5-oxopyrrolidine-3-sulfonyl fluoride.
| Compound Name | 1-[3-[dimethoxy(methyl)silyl]propyl]-5-oxopyrrolidine-3-sulfonyl fluoride |
|---|---|
| PubChem CID | 168714021 |
| Molecular Formula | C10H20FNO5SSi |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 1-[3-[dimethoxy(methyl)silyl]propyl]-5-oxopyrrolidine-3-sulfonyl fluoride |
| SMILES | CO[Si](C)(CCCN1CC(S(=O)(=O)F)CC1=O)OC |
| InChI | InChI=1S/C10H20FNO5SSi/c1-16-19(3,17-2)6-4-5-12-8-9(7-10(12)13)18(11,14)15/h9H,4-8H2,1-3H3 |
| InChIKey | DJHBHGBRBMMERP-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|