C12H23FN2O3S — CID 168713569
1-[2-[di(propan-2-yl)amino]ethyl]-5-oxopyrrolidine-3-sulfonyl fluoride (PubChem CID 168713569) has the molecular formula C12H23FN2O3S and a molecular weight of 294.39 g/mol. Its IUPAC name is 1-[2-[di(propan-2-yl)amino]ethyl]-5-oxopyrrolidine-3-sulfonyl fluoride.
| Compound Name | 1-[2-[di(propan-2-yl)amino]ethyl]-5-oxopyrrolidine-3-sulfonyl fluoride |
|---|---|
| PubChem CID | 168713569 |
| Molecular Formula | C12H23FN2O3S |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 1-[2-[di(propan-2-yl)amino]ethyl]-5-oxopyrrolidine-3-sulfonyl fluoride |
| SMILES | CC(C)N(CCN1CC(S(=O)(=O)F)CC1=O)C(C)C |
| InChI | InChI=1S/C12H23FN2O3S/c1-9(2)15(10(3)4)6-5-14-8-11(7-12(14)16)19(13,17)18/h9-11H,5-8H2,1-4H3 |
| InChIKey | OLHBTWPWXCJVLZ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |