C11H23FN4O3S — CID 168714844
1-[2-[3-(2-aminoethylamino)propylamino]ethyl]-5-oxopyrrolidine-3-sulfonyl fluoride (PubChem CID 168714844) has the molecular formula C11H23FN4O3S and a molecular weight of 310.40 g/mol. Its IUPAC name is 1-[2-[3-(2-aminoethylamino)propylamino]ethyl]-5-oxopyrrolidine-3-sulfonyl fluoride.
| Compound Name | 1-[2-[3-(2-aminoethylamino)propylamino]ethyl]-5-oxopyrrolidine-3-sulfonyl fluoride |
|---|---|
| PubChem CID | 168714844 |
| Molecular Formula | C11H23FN4O3S |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 1-[2-[3-(2-aminoethylamino)propylamino]ethyl]-5-oxopyrrolidine-3-sulfonyl fluoride |
| SMILES | NCCNCCCNCCN1CC(S(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C11H23FN4O3S/c12-20(18,19)10-8-11(17)16(9-10)7-6-15-4-1-3-14-5-2-13/h10,14-15H,1-9,13H2 |
| InChIKey | FFOXHZIWDHMYGZ-UHFFFAOYSA-N |
| XLogP | -1.59 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | -1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|