C11H14FN3O3S — CID 168714851
5-oxo-1-[2-(pyridin-4-ylamino)ethyl]pyrrolidine-3-sulfonyl fluoride (PubChem CID 168714851) has the molecular formula C11H14FN3O3S and a molecular weight of 287.32 g/mol. Its IUPAC name is 5-oxo-1-[2-(pyridin-4-ylamino)ethyl]pyrrolidine-3-sulfonyl fluoride.
| Compound Name | 5-oxo-1-[2-(pyridin-4-ylamino)ethyl]pyrrolidine-3-sulfonyl fluoride |
|---|---|
| PubChem CID | 168714851 |
| Molecular Formula | C11H14FN3O3S |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.07 |
| IUPAC Name | 5-oxo-1-[2-(pyridin-4-ylamino)ethyl]pyrrolidine-3-sulfonyl fluoride |
| SMILES | O=C1CC(S(=O)(=O)F)CN1CCNc1ccncc1 |
| InChI | InChI=1S/C11H14FN3O3S/c12-19(17,18)10-7-11(16)15(8-10)6-5-14-9-1-3-13-4-2-9/h1-4,10H,5-8H2,(H,13,14) |
| InChIKey | QFXFUNLOSQQIMF-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |