C14H14FN3O3S — CID 168714914
5-oxo-1-(2-quinoxalin-6-ylethyl)pyrrolidine-3-sulfonyl fluoride (PubChem CID 168714914) has the molecular formula C14H14FN3O3S and a molecular weight of 323.35 g/mol. Its IUPAC name is 5-oxo-1-(2-quinoxalin-6-ylethyl)pyrrolidine-3-sulfonyl fluoride.
| Compound Name | 5-oxo-1-(2-quinoxalin-6-ylethyl)pyrrolidine-3-sulfonyl fluoride |
|---|---|
| PubChem CID | 168714914 |
| Molecular Formula | C14H14FN3O3S |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.07 |
| IUPAC Name | 5-oxo-1-(2-quinoxalin-6-ylethyl)pyrrolidine-3-sulfonyl fluoride |
| SMILES | O=C1CC(S(=O)(=O)F)CN1CCc1ccc2nccnc2c1 |
| InChI | InChI=1S/C14H14FN3O3S/c15-22(20,21)11-8-14(19)18(9-11)6-3-10-1-2-12-13(7-10)17-5-4-16-12/h1-2,4-5,7,11H,3,6,8-9H2 |
| InChIKey | DUMGYMFQLIQZTD-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 80.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |