C16H17ClN2O — CID 168508323
4-(chloromethyl)-1-(2-quinolin-6-ylethyl)pyrrolidin-2-one (PubChem CID 168508323) has the molecular formula C16H17ClN2O and a molecular weight of 288.78 g/mol. Its IUPAC name is 4-(chloromethyl)-1-(2-quinolin-6-ylethyl)pyrrolidin-2-one.
| Compound Name | 4-(chloromethyl)-1-(2-quinolin-6-ylethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168508323 |
| Molecular Formula | C16H17ClN2O |
| Molecular Weight | 288.78 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 4-(chloromethyl)-1-(2-quinolin-6-ylethyl)pyrrolidin-2-one |
| SMILES | O=C1CC(CCl)CN1CCc1ccc2ncccc2c1 |
| InChI | InChI=1S/C16H17ClN2O/c17-10-13-9-16(20)19(11-13)7-5-12-3-4-15-14(8-12)2-1-6-18-15/h1-4,6,8,13H,5,7,9-11H2 |
| InChIKey | WRKRBFQIDJJMRF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.78 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|