About 1-(2,2-dimethylpropyl)-5-oxopyrrolidine-3-sulfonyl fluoride
1-(2,2-dimethylpropyl)-5-oxopyrrolidine-3-sulfonyl fluoride (PubChem CID 168713447) has the molecular formula C9H16FNO3S
and a molecular weight of 237.30 g/mol. Its IUPAC name is 1-(2,2-dimethylpropyl)-5-oxopyrrolidine-3-sulfonyl fluoride.
Analyze 1-(2,2-dimethylpropyl)-5-oxopyrrolidine-3-sulfonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,2-dimethylpropyl)-5-oxopyrrolidine-3-sulfonyl fluoride?
The IUPAC name of 1-(2,2-dimethylpropyl)-5-oxopyrrolidine-3-sulfonyl fluoride (CID 168713447) is 1-(2,2-dimethylpropyl)-5-oxopyrrolidine-3-sulfonyl fluoride.
What is the SMILES notation for 1-(2,2-dimethylpropyl)-5-oxopyrrolidine-3-sulfonyl fluoride?
The canonical SMILES for 1-(2,2-dimethylpropyl)-5-oxopyrrolidine-3-sulfonyl fluoride is CC(C)(C)CN1CC(S(=O)(=O)F)CC1=O.
What is the InChIKey of 1-(2,2-dimethylpropyl)-5-oxopyrrolidine-3-sulfonyl fluoride?
The InChIKey is JTFABEHNPZEEKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16FNO3S/c1-9(2,3)6-11-5-7(4-8(11)12)15(10,13)14/h7H,4-6H2,1-3H3.
What are the key properties of 1-(2,2-dimethylpropyl)-5-oxopyrrolidine-3-sulfonyl fluoride?
1-(2,2-dimethylpropyl)-5-oxopyrrolidine-3-sulfonyl fluoride has a molecular weight of 237.30 g/mol, XLogP of 0.93, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,2-dimethylpropyl)-5-oxopyrrolidine-3-sulfonyl fluoride is sourced from PubChem (CID 168713447), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).