C12H24FNO4SSi — CID 168713516
1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-oxopyrrolidine-3-sulfonyl fluoride (PubChem CID 168713516) has the molecular formula C12H24FNO4SSi and a molecular weight of 325.48 g/mol. Its IUPAC name is 1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-oxopyrrolidine-3-sulfonyl fluoride.
| Compound Name | 1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-oxopyrrolidine-3-sulfonyl fluoride |
|---|---|
| PubChem CID | 168713516 |
| Molecular Formula | C12H24FNO4SSi |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-oxopyrrolidine-3-sulfonyl fluoride |
| SMILES | CC(C)(C)[Si](C)(C)OCCN1CC(S(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C12H24FNO4SSi/c1-12(2,3)20(4,5)18-7-6-14-9-10(8-11(14)15)19(13,16)17/h10H,6-9H2,1-5H3 |
| InChIKey | IOPHXLOSYADFMQ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|