C14H27NO3SSi — CID 168704681
S-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-oxopyrrolidin-3-yl] ethanethioate (PubChem CID 168704681) has the molecular formula C14H27NO3SSi and a molecular weight of 317.53 g/mol. Its IUPAC name is S-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-oxopyrrolidin-3-yl] ethanethioate.
| Compound Name | S-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-oxopyrrolidin-3-yl] ethanethioate |
|---|---|
| PubChem CID | 168704681 |
| Molecular Formula | C14H27NO3SSi |
| Molecular Weight | 317.53 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | S-[1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-5-oxopyrrolidin-3-yl] ethanethioate |
| SMILES | CC(=O)SC1CC(=O)N(CCO[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C14H27NO3SSi/c1-11(16)19-12-9-13(17)15(10-12)7-8-18-20(5,6)14(2,3)4/h12H,7-10H2,1-6H3 |
| InChIKey | IVRZQWMHFSWCTB-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.53 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|