C9H15NO4S — CID 168704528
S-[1-(2,3-dihydroxypropyl)-5-oxopyrrolidin-3-yl] ethanethioate (PubChem CID 168704528) has the molecular formula C9H15NO4S and a molecular weight of 233.29 g/mol. Its IUPAC name is S-[1-(2,3-dihydroxypropyl)-5-oxopyrrolidin-3-yl] ethanethioate.
| Compound Name | S-[1-(2,3-dihydroxypropyl)-5-oxopyrrolidin-3-yl] ethanethioate |
|---|---|
| PubChem CID | 168704528 |
| Molecular Formula | C9H15NO4S |
| Molecular Weight | 233.29 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | S-[1-(2,3-dihydroxypropyl)-5-oxopyrrolidin-3-yl] ethanethioate |
| SMILES | CC(=O)SC1CC(=O)N(CC(O)CO)C1 |
| InChI | InChI=1S/C9H15NO4S/c1-6(12)15-8-2-9(14)10(4-8)3-7(13)5-11/h7-8,11,13H,2-5H2,1H3 |
| InChIKey | JTFICZXJIHWLAA-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.29 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|