C12H16N2O2S — CID 168706065
S-[5-oxo-1-[2-(1H-pyrrol-3-yl)ethyl]pyrrolidin-3-yl] ethanethioate (PubChem CID 168706065) has the molecular formula C12H16N2O2S and a molecular weight of 252.34 g/mol. Its IUPAC name is S-[5-oxo-1-[2-(1H-pyrrol-3-yl)ethyl]pyrrolidin-3-yl] ethanethioate.
| Compound Name | S-[5-oxo-1-[2-(1H-pyrrol-3-yl)ethyl]pyrrolidin-3-yl] ethanethioate |
|---|---|
| PubChem CID | 168706065 |
| Molecular Formula | C12H16N2O2S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | S-[5-oxo-1-[2-(1H-pyrrol-3-yl)ethyl]pyrrolidin-3-yl] ethanethioate |
| SMILES | CC(=O)SC1CC(=O)N(CCc2cc[nH]c2)C1 |
| InChI | InChI=1S/C12H16N2O2S/c1-9(15)17-11-6-12(16)14(8-11)5-3-10-2-4-13-7-10/h2,4,7,11,13H,3,5-6,8H2,1H3 |
| InChIKey | FJHWSXQAPBZJGY-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|