C10H14N2OS — CID 168709391
1-[2-(1H-pyrrol-3-yl)ethyl]-4-sulfanylpyrrolidin-2-one (PubChem CID 168709391) has the molecular formula C10H14N2OS and a molecular weight of 210.30 g/mol. Its IUPAC name is 1-[2-(1H-pyrrol-3-yl)ethyl]-4-sulfanylpyrrolidin-2-one.
| Compound Name | 1-[2-(1H-pyrrol-3-yl)ethyl]-4-sulfanylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168709391 |
| Molecular Formula | C10H14N2OS |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 1-[2-(1H-pyrrol-3-yl)ethyl]-4-sulfanylpyrrolidin-2-one |
| SMILES | O=C1CC(S)CN1CCc1cc[nH]c1 |
| InChI | InChI=1S/C10H14N2OS/c13-10-5-9(14)7-12(10)4-2-8-1-3-11-6-8/h1,3,6,9,11,14H,2,4-5,7H2 |
| InChIKey | AYKHOTNINVRVDW-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|