C14H19NO4S — CID 168708638
1-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethyl]-4-sulfanylpyrrolidin-2-one (PubChem CID 168708638) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is 1-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethyl]-4-sulfanylpyrrolidin-2-one.
| Compound Name | 1-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethyl]-4-sulfanylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168708638 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | 1-[2-(4-hydroxy-3,5-dimethoxyphenyl)ethyl]-4-sulfanylpyrrolidin-2-one |
| SMILES | COc1cc(CCN2CC(S)CC2=O)cc(OC)c1O |
| InChI | InChI=1S/C14H19NO4S/c1-18-11-5-9(6-12(19-2)14(11)17)3-4-15-8-10(20)7-13(15)16/h5-6,10,17,20H,3-4,7-8H2,1-2H3 |
| InChIKey | JBWSVGSBUCUPJS-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|