C12H13F2NOS — CID 168709394
1-[2-(3,5-difluorophenyl)ethyl]-4-sulfanylpyrrolidin-2-one (PubChem CID 168709394) has the molecular formula C12H13F2NOS and a molecular weight of 257.30 g/mol. Its IUPAC name is 1-[2-(3,5-difluorophenyl)ethyl]-4-sulfanylpyrrolidin-2-one.
| Compound Name | 1-[2-(3,5-difluorophenyl)ethyl]-4-sulfanylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168709394 |
| Molecular Formula | C12H13F2NOS |
| Molecular Weight | 257.30 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 1-[2-(3,5-difluorophenyl)ethyl]-4-sulfanylpyrrolidin-2-one |
| SMILES | O=C1CC(S)CN1CCc1cc(F)cc(F)c1 |
| InChI | InChI=1S/C12H13F2NOS/c13-9-3-8(4-10(14)5-9)1-2-15-7-11(17)6-12(15)16/h3-5,11,17H,1-2,6-7H2 |
| InChIKey | ZWHSOVYWXXWHJX-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.30 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|