C9H12N2O2S — CID 168709427
1-[2-(1,3-oxazol-5-yl)ethyl]-4-sulfanylpyrrolidin-2-one (PubChem CID 168709427) has the molecular formula C9H12N2O2S and a molecular weight of 212.27 g/mol. Its IUPAC name is 1-[2-(1,3-oxazol-5-yl)ethyl]-4-sulfanylpyrrolidin-2-one.
| Compound Name | 1-[2-(1,3-oxazol-5-yl)ethyl]-4-sulfanylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168709427 |
| Molecular Formula | C9H12N2O2S |
| Molecular Weight | 212.27 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 1-[2-(1,3-oxazol-5-yl)ethyl]-4-sulfanylpyrrolidin-2-one |
| SMILES | O=C1CC(S)CN1CCc1cnco1 |
| InChI | InChI=1S/C9H12N2O2S/c12-9-3-8(14)5-11(9)2-1-7-4-10-6-13-7/h4,6,8,14H,1-3,5H2 |
| InChIKey | FXUKZFQIPYUVPT-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 46.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.27 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|