C11H12N2O2 — CID 168501702
4-ethynyl-1-[2-(1,3-oxazol-5-yl)ethyl]pyrrolidin-2-one (PubChem CID 168501702) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is 4-ethynyl-1-[2-(1,3-oxazol-5-yl)ethyl]pyrrolidin-2-one.
| Compound Name | 4-ethynyl-1-[2-(1,3-oxazol-5-yl)ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 168501702 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 4-ethynyl-1-[2-(1,3-oxazol-5-yl)ethyl]pyrrolidin-2-one |
| SMILES | C#CC1CC(=O)N(CCc2cnco2)C1 |
| InChI | InChI=1S/C11H12N2O2/c1-2-9-5-11(14)13(7-9)4-3-10-6-12-8-15-10/h1,6,8-9H,3-5,7H2 |
| InChIKey | DJQZXLDJWGTHAK-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|