About 4-(bromomethyl)-1-[2-(1,3-oxazol-5-yl)ethyl]pyrrolidin-2-one
4-(bromomethyl)-1-[2-(1,3-oxazol-5-yl)ethyl]pyrrolidin-2-one (PubChem CID 168505023) has the molecular formula C10H13BrN2O2
and a molecular weight of 273.13 g/mol. Its IUPAC name is 4-(bromomethyl)-1-[2-(1,3-oxazol-5-yl)ethyl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | 4-(bromomethyl)-1-[2-(1,3-oxazol-5-yl)ethyl]pyrrolidin-2-one |
| PubChem CID | 168505023 |
| Molecular Formula | C10H13BrN2O2 |
| Molecular Weight | 273.13 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | 4-(bromomethyl)-1-[2-(1,3-oxazol-5-yl)ethyl]pyrrolidin-2-one |
| SMILES | O=C1CC(CBr)CN1CCc1cnco1 |
| InChI | InChI=1S/C10H13BrN2O2/c11-4-8-3-10(14)13(6-8)2-1-9-5-12-7-15-9/h5,7-8H,1-4,6H2 |
| InChIKey | MVGFMJCNSAMLMD-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.13 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-(bromomethyl)-1-[2-(1,3-oxazol-5-yl)ethyl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(bromomethyl)-1-[2-(1,3-oxazol-5-yl)ethyl]pyrrolidin-2-one?
The IUPAC name of 4-(bromomethyl)-1-[2-(1,3-oxazol-5-yl)ethyl]pyrrolidin-2-one (CID 168505023) is 4-(bromomethyl)-1-[2-(1,3-oxazol-5-yl)ethyl]pyrrolidin-2-one.
What is the SMILES notation for 4-(bromomethyl)-1-[2-(1,3-oxazol-5-yl)ethyl]pyrrolidin-2-one?
The canonical SMILES for 4-(bromomethyl)-1-[2-(1,3-oxazol-5-yl)ethyl]pyrrolidin-2-one is O=C1CC(CBr)CN1CCc1cnco1.
What is the InChIKey of 4-(bromomethyl)-1-[2-(1,3-oxazol-5-yl)ethyl]pyrrolidin-2-one?
The InChIKey is MVGFMJCNSAMLMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13BrN2O2/c11-4-8-3-10(14)13(6-8)2-1-9-5-12-7-15-9/h5,7-8H,1-4,6H2.
What are the key properties of 4-(bromomethyl)-1-[2-(1,3-oxazol-5-yl)ethyl]pyrrolidin-2-one?
4-(bromomethyl)-1-[2-(1,3-oxazol-5-yl)ethyl]pyrrolidin-2-one has a molecular weight of 273.13 g/mol, XLogP of 1.46, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(bromomethyl)-1-[2-(1,3-oxazol-5-yl)ethyl]pyrrolidin-2-one is sourced from PubChem (CID 168505023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).