C6H9F2NOS — CID 168709258
1-(2,2-difluoroethyl)-4-sulfanylpyrrolidin-2-one (PubChem CID 168709258) has the molecular formula C6H9F2NOS and a molecular weight of 181.21 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-4-sulfanylpyrrolidin-2-one.
| Compound Name | 1-(2,2-difluoroethyl)-4-sulfanylpyrrolidin-2-one |
|---|---|
| PubChem CID | 168709258 |
| Molecular Formula | C6H9F2NOS |
| Molecular Weight | 181.21 g/mol |
| Exact Mass | 181.04 |
| IUPAC Name | 1-(2,2-difluoroethyl)-4-sulfanylpyrrolidin-2-one |
| SMILES | O=C1CC(S)CN1CC(F)F |
| InChI | InChI=1S/C6H9F2NOS/c7-5(8)3-9-2-4(11)1-6(9)10/h4-5,11H,1-3H2 |
| InChIKey | QWXVSBMJSGGQIM-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.21 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|