C7H10BrF2NO — CID 168504854
4-(bromomethyl)-1-(2,2-difluoroethyl)pyrrolidin-2-one (PubChem CID 168504854) has the molecular formula C7H10BrF2NO and a molecular weight of 242.06 g/mol. Its IUPAC name is 4-(bromomethyl)-1-(2,2-difluoroethyl)pyrrolidin-2-one.
| Compound Name | 4-(bromomethyl)-1-(2,2-difluoroethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168504854 |
| Molecular Formula | C7H10BrF2NO |
| Molecular Weight | 242.06 g/mol |
| Exact Mass | 240.99 |
| IUPAC Name | 4-(bromomethyl)-1-(2,2-difluoroethyl)pyrrolidin-2-one |
| SMILES | O=C1CC(CBr)CN1CC(F)F |
| InChI | InChI=1S/C7H10BrF2NO/c8-2-5-1-7(12)11(3-5)4-6(9)10/h5-6H,1-4H2 |
| InChIKey | CHLHNWSHGFTSKS-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.06 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|