C13H23BrN2O2 — CID 168503140
4-(bromomethyl)-1-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]ethyl]pyrrolidin-2-one (PubChem CID 168503140) has the molecular formula C13H23BrN2O2 and a molecular weight of 319.24 g/mol. Its IUPAC name is 4-(bromomethyl)-1-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]ethyl]pyrrolidin-2-one.
| Compound Name | 4-(bromomethyl)-1-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]ethyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 168503140 |
| Molecular Formula | C13H23BrN2O2 |
| Molecular Weight | 319.24 g/mol |
| Exact Mass | 318.09 |
| IUPAC Name | 4-(bromomethyl)-1-[2-[(2S,6R)-2,6-dimethylmorpholin-4-yl]ethyl]pyrrolidin-2-one |
| SMILES | C[C@@H]1CN(CCN2CC(CBr)CC2=O)C[C@H](C)O1 |
| InChI | InChI=1S/C13H23BrN2O2/c1-10-7-15(8-11(2)18-10)3-4-16-9-12(6-14)5-13(16)17/h10-12H,3-9H2,1-2H3/t10-,11+,12? |
| InChIKey | SAQUSJUCHCBWNU-FOSCPWQOSA-N |
| XLogP | 1.34 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.24 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|