C11H20BrNO3 — CID 168503820
4-(bromomethyl)-1-(2,2-diethoxyethyl)pyrrolidin-2-one (PubChem CID 168503820) has the molecular formula C11H20BrNO3 and a molecular weight of 294.19 g/mol. Its IUPAC name is 4-(bromomethyl)-1-(2,2-diethoxyethyl)pyrrolidin-2-one.
| Compound Name | 4-(bromomethyl)-1-(2,2-diethoxyethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168503820 |
| Molecular Formula | C11H20BrNO3 |
| Molecular Weight | 294.19 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 4-(bromomethyl)-1-(2,2-diethoxyethyl)pyrrolidin-2-one |
| SMILES | CCOC(CN1CC(CBr)CC1=O)OCC |
| InChI | InChI=1S/C11H20BrNO3/c1-3-15-11(16-4-2)8-13-7-9(6-12)5-10(13)14/h9,11H,3-8H2,1-2H3 |
| InChIKey | SGHXDMBFQZQVNH-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.19 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|