C10H18ClNO5S — CID 168711208
1-(2,2-diethoxyethyl)-5-oxopyrrolidine-3-sulfonyl chloride (PubChem CID 168711208) has the molecular formula C10H18ClNO5S and a molecular weight of 299.78 g/mol. Its IUPAC name is 1-(2,2-diethoxyethyl)-5-oxopyrrolidine-3-sulfonyl chloride.
| Compound Name | 1-(2,2-diethoxyethyl)-5-oxopyrrolidine-3-sulfonyl chloride |
|---|---|
| PubChem CID | 168711208 |
| Molecular Formula | C10H18ClNO5S |
| Molecular Weight | 299.78 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 1-(2,2-diethoxyethyl)-5-oxopyrrolidine-3-sulfonyl chloride |
| SMILES | CCOC(CN1CC(S(=O)(=O)Cl)CC1=O)OCC |
| InChI | InChI=1S/C10H18ClNO5S/c1-3-16-10(17-4-2)7-12-6-8(5-9(12)13)18(11,14)15/h8,10H,3-7H2,1-2H3 |
| InChIKey | DDPGJVHOLPPECP-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.78 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|