C15H19NO4S — CID 168705314
S-[1-[(3,5-dimethoxyphenyl)methyl]-5-oxopyrrolidin-3-yl] ethanethioate (PubChem CID 168705314) has the molecular formula C15H19NO4S and a molecular weight of 309.39 g/mol. Its IUPAC name is S-[1-[(3,5-dimethoxyphenyl)methyl]-5-oxopyrrolidin-3-yl] ethanethioate.
| Compound Name | S-[1-[(3,5-dimethoxyphenyl)methyl]-5-oxopyrrolidin-3-yl] ethanethioate |
|---|---|
| PubChem CID | 168705314 |
| Molecular Formula | C15H19NO4S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | S-[1-[(3,5-dimethoxyphenyl)methyl]-5-oxopyrrolidin-3-yl] ethanethioate |
| SMILES | COc1cc(CN2CC(SC(C)=O)CC2=O)cc(OC)c1 |
| InChI | InChI=1S/C15H19NO4S/c1-10(17)21-14-7-15(18)16(9-14)8-11-4-12(19-2)6-13(5-11)20-3/h4-6,14H,7-9H2,1-3H3 |
| InChIKey | WWGUFUXGFHETCR-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|