C18H18N2O3S — CID 87950735
S-[(3R)-5-oxo-1-[(6-phenoxy-3-pyridinyl)methyl]pyrrolidin-3-yl] ethanethioate (PubChem CID 87950735) has the molecular formula C18H18N2O3S and a molecular weight of 342.42 g/mol. Its IUPAC name is S-[(3R)-5-oxo-1-[(6-phenoxy-3-pyridinyl)methyl]pyrrolidin-3-yl] ethanethioate.
| Compound Name | S-[(3R)-5-oxo-1-[(6-phenoxy-3-pyridinyl)methyl]pyrrolidin-3-yl] ethanethioate |
|---|---|
| PubChem CID | 87950735 |
| Molecular Formula | C18H18N2O3S |
| Molecular Weight | 342.42 g/mol |
| Exact Mass | 342.10 |
| IUPAC Name | S-[(3R)-5-oxo-1-[(6-phenoxy-3-pyridinyl)methyl]pyrrolidin-3-yl] ethanethioate |
| SMILES | CC(=O)S[C@@H]1CC(=O)N(Cc2ccc(Oc3ccccc3)nc2)C1 |
| InChI | InChI=1S/C18H18N2O3S/c1-13(21)24-16-9-18(22)20(12-16)11-14-7-8-17(19-10-14)23-15-5-3-2-4-6-15/h2-8,10,16H,9,11-12H2,1H3/t16-/m1/s1 |
| InChIKey | LYWAIJQRTPLPNS-MRXNPFEDSA-N |
| XLogP | 3.25 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.42 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|