C21H22FN3O5S — CID 86599816
4-[[(3R)-1-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]-5-oxopyrrolidin-3-yl]sulfanylcarbonylamino]butanoic acid (PubChem CID 86599816) has the molecular formula C21H22FN3O5S and a molecular weight of 447.49 g/mol. Its IUPAC name is 4-[[(3R)-1-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]-5-oxopyrrolidin-3-yl]sulfanylcarbonylamino]butanoic acid.
| Compound Name | 4-[[(3R)-1-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]-5-oxopyrrolidin-3-yl]sulfanylcarbonylamino]butanoic acid |
|---|---|
| PubChem CID | 86599816 |
| Molecular Formula | C21H22FN3O5S |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | 4-[[(3R)-1-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]-5-oxopyrrolidin-3-yl]sulfanylcarbonylamino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)S[C@@H]1CC(=O)N(Cc2ccc(Oc3ccc(F)cc3)nc2)C1 |
| InChI | InChI=1S/C21H22FN3O5S/c22-15-4-6-16(7-5-15)30-18-8-3-14(11-24-18)12-25-13-17(10-19(25)26)31-21(29)23-9-1-2-20(27)28/h3-8,11,17H,1-2,9-10,12-13H2,(H,23,29)(H,27,28)/t17-/m1/s1 |
| InChIKey | PAJFURJUAVTLQE-QGZVFWFLSA-N |
| XLogP | 3.42 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|