C18H18FN3O2S2 — CID 87950842
[(3R)-1-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]-5-oxopyrrolidin-3-yl]methyl carbamodithioate (PubChem CID 87950842) has the molecular formula C18H18FN3O2S2 and a molecular weight of 391.49 g/mol. Its IUPAC name is [(3R)-1-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]-5-oxopyrrolidin-3-yl]methyl carbamodithioate.
| Compound Name | [(3R)-1-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]-5-oxopyrrolidin-3-yl]methyl carbamodithioate |
|---|---|
| PubChem CID | 87950842 |
| Molecular Formula | C18H18FN3O2S2 |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | [(3R)-1-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]-5-oxopyrrolidin-3-yl]methyl carbamodithioate |
| SMILES | NC(=S)SC[C@@H]1CC(=O)N(Cc2ccc(Oc3ccc(F)cc3)nc2)C1 |
| InChI | InChI=1S/C18H18FN3O2S2/c19-14-2-4-15(5-3-14)24-16-6-1-12(8-21-16)9-22-10-13(7-17(22)23)11-26-18(20)25/h1-6,8,13H,7,9-11H2,(H2,20,25)/t13-/m1/s1 |
| InChIKey | BSHVWPAIOYOIHL-CYBMUJFWSA-N |
| XLogP | 3.34 |
| TPSA | 68.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|