C19H18FNO3S — CID 22093178
S-[(3S)-1-[[4-(4-fluorophenoxy)phenyl]methyl]-5-oxopyrrolidin-3-yl] ethanethioate (PubChem CID 22093178) has the molecular formula C19H18FNO3S and a molecular weight of 359.42 g/mol. Its IUPAC name is S-[(3S)-1-[[4-(4-fluorophenoxy)phenyl]methyl]-5-oxopyrrolidin-3-yl] ethanethioate.
| Compound Name | S-[(3S)-1-[[4-(4-fluorophenoxy)phenyl]methyl]-5-oxopyrrolidin-3-yl] ethanethioate |
|---|---|
| PubChem CID | 22093178 |
| Molecular Formula | C19H18FNO3S |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | S-[(3S)-1-[[4-(4-fluorophenoxy)phenyl]methyl]-5-oxopyrrolidin-3-yl] ethanethioate |
| SMILES | CC(=O)S[C@H]1CC(=O)N(Cc2ccc(Oc3ccc(F)cc3)cc2)C1 |
| InChI | InChI=1S/C19H18FNO3S/c1-13(22)25-18-10-19(23)21(12-18)11-14-2-6-16(7-3-14)24-17-8-4-15(20)5-9-17/h2-9,18H,10-12H2,1H3/t18-/m0/s1 |
| InChIKey | AZXIXUVSCDMUAZ-SFHVURJKSA-N |
| XLogP | 4.00 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|