C18H18FN3O4S — CID 87951253
[(3R)-1-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]-5-oxopyrrolidin-3-yl]methylsulfanylcarbamic acid (PubChem CID 87951253) has the molecular formula C18H18FN3O4S and a molecular weight of 391.42 g/mol. Its IUPAC name is [(3R)-1-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]-5-oxopyrrolidin-3-yl]methylsulfanylcarbamic acid.
| Compound Name | [(3R)-1-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]-5-oxopyrrolidin-3-yl]methylsulfanylcarbamic acid |
|---|---|
| PubChem CID | 87951253 |
| Molecular Formula | C18H18FN3O4S |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | [(3R)-1-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]-5-oxopyrrolidin-3-yl]methylsulfanylcarbamic acid |
| SMILES | O=C(O)NSC[C@@H]1CC(=O)N(Cc2ccc(Oc3ccc(F)cc3)nc2)C1 |
| InChI | InChI=1S/C18H18FN3O4S/c19-14-2-4-15(5-3-14)26-16-6-1-12(8-20-16)9-22-10-13(7-17(22)23)11-27-21-18(24)25/h1-6,8,13,21H,7,9-11H2,(H,24,25)/t13-/m1/s1 |
| InChIKey | AHXZIDWIKVEJFY-CYBMUJFWSA-N |
| XLogP | 3.28 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|