C18H17FN4O3 — CID 98258923
(4S)-N-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]-1,3-dimethyl-5-oxo-4H-pyrazole-4-carboxamide (PubChem CID 98258923) has the molecular formula C18H17FN4O3 and a molecular weight of 356.36 g/mol. Its IUPAC name is (4S)-N-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]-1,3-dimethyl-5-oxo-4H-pyrazole-4-carboxamide.
| Compound Name | (4S)-N-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]-1,3-dimethyl-5-oxo-4H-pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 98258923 |
| Molecular Formula | C18H17FN4O3 |
| Molecular Weight | 356.36 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | (4S)-N-[[6-(4-fluorophenoxy)-3-pyridinyl]methyl]-1,3-dimethyl-5-oxo-4H-pyrazole-4-carboxamide |
| SMILES | CC1=NN(C)C(=O)[C@@H]1C(=O)NCc1ccc(Oc2ccc(F)cc2)nc1 |
| InChI | InChI=1S/C18H17FN4O3/c1-11-16(18(25)23(2)22-11)17(24)21-10-12-3-8-15(20-9-12)26-14-6-4-13(19)5-7-14/h3-9,16H,10H2,1-2H3,(H,21,24)/t16-/m0/s1 |
| InChIKey | QVOLFGPLYAKERP-INIZCTEOSA-N |
| XLogP | 2.09 |
| TPSA | 83.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.36 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|